C17H13Cl6NO5 — CID 98118238
(1S,2R,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(2,5-dimethoxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98118238) has the molecular formula C17H13Cl6NO5 and a molecular weight of 524.01 g/mol. Its IUPAC name is (1S,2R,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(2,5-dimethoxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(2,5-dimethoxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98118238 |
| Molecular Formula | C17H13Cl6NO5 |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 520.89 |
| IUPAC Name | (1S,2R,3S,4S)-1,4,5,6,7,7-hexachloro-3-[(2,5-dimethoxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H]2[C@H](C(=O)O)[C@]3(Cl)C(Cl)=C(Cl)[C@]2(Cl)C3(Cl)Cl)c1 |
| InChI | InChI=1S/C17H13Cl6NO5/c1-28-6-3-4-8(29-2)7(5-6)24-13(25)9-10(14(26)27)16(21)12(19)11(18)15(9,20)17(16,22)23/h3-5,9-10H,1-2H3,(H,24,25)(H,26,27)/t9-,10+,15-,16-/m0/s1 |
| InChIKey | AOUJGQLGEAZILY-UIHHKEIPSA-N |
| XLogP | 4.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|