C33H31NO3 — CID 98118941
(1R,2S,6R,7R)-4-(2,3-dimethylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 98118941) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-(2,3-dimethylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2S,6R,7R)-4-(2,3-dimethylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 98118941 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (1R,2S,6R,7R)-4-(2,3-dimethylphenyl)-1,7-diethyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | CC[C@]12C(=O)[C@@](CC)(C(c3ccccc3)=C1c1ccccc1)[C@H]1C(=O)N(c3cccc(C)c3C)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H31NO3/c1-5-32-25(22-15-9-7-10-16-22)26(23-17-11-8-12-18-23)33(6-2,31(32)37)28-27(32)29(35)34(30(28)36)24-19-13-14-20(3)21(24)4/h7-19,27-28H,5-6H2,1-4H3/t27-,28+,32-,33-/m0/s1 |
| InChIKey | AUYPTYLMTORAHP-SNJRAOIRSA-N |
| XLogP | 6.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|