C22H25NO4 — CID 98119849
ethyl 2-[(2S)-6-cyclohexyl-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl]-2-oxoacetate (PubChem CID 98119849) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 2-[(2S)-6-cyclohexyl-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(2S)-6-cyclohexyl-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 98119849 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl 2-[(2S)-6-cyclohexyl-1-oxo-2,3,4,9-tetrahydrocarbazol-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@H]1CCc2c([nH]c3ccc(C4CCCCC4)cc23)C1=O |
| InChI | InChI=1S/C22H25NO4/c1-2-27-22(26)21(25)16-10-9-15-17-12-14(13-6-4-3-5-7-13)8-11-18(17)23-19(15)20(16)24/h8,11-13,16,23H,2-7,9-10H2,1H3/t16-/m0/s1 |
| InChIKey | ILIBTDGADGVARC-INIZCTEOSA-N |
| XLogP | 4.09 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|