C29H27Cl2NO5 — CID 98120656
cyclopentyl (4R,7R)-4-(6-chloro-1,3-benzodioxol-5-yl)-7-(4-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98120656) has the molecular formula C29H27Cl2NO5 and a molecular weight of 540.44 g/mol. Its IUPAC name is cyclopentyl (4R,7R)-4-(6-chloro-1,3-benzodioxol-5-yl)-7-(4-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | cyclopentyl (4R,7R)-4-(6-chloro-1,3-benzodioxol-5-yl)-7-(4-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98120656 |
| Molecular Formula | C29H27Cl2NO5 |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | cyclopentyl (4R,7R)-4-(6-chloro-1,3-benzodioxol-5-yl)-7-(4-chlorophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCC2)[C@H](c2cc3c(cc2Cl)OCO3)C2=C(C[C@@H](c3ccc(Cl)cc3)CC2=O)N1 |
| InChI | InChI=1S/C29H27Cl2NO5/c1-15-26(29(34)37-19-4-2-3-5-19)27(20-12-24-25(13-21(20)31)36-14-35-24)28-22(32-15)10-17(11-23(28)33)16-6-8-18(30)9-7-16/h6-9,12-13,17,19,27,32H,2-5,10-11,14H2,1H3/t17-,27+/m1/s1 |
| InChIKey | VJUKUZJRVPGNJL-CRYYWNKWSA-N |
| XLogP | 6.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |