C28H28N4O7 — CID 98121164
2-[4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-methoxyphenoxy]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 98121164) has the molecular formula C28H28N4O7 and a molecular weight of 532.55 g/mol. Its IUPAC name is 2-[4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-methoxyphenoxy]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-methoxyphenoxy]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 98121164 |
| Molecular Formula | C28H28N4O7 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 2-[4-[(4S)-2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl]-2-methoxyphenoxy]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | COc1cc([C@H]2C(C#N)=C(N)OC3=C2C(=O)CC(C)(C)C3)ccc1OCC(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C28H28N4O7/c1-15-5-7-17(32(35)36)10-19(15)31-24(34)14-38-21-8-6-16(9-22(21)37-4)25-18(13-29)27(30)39-23-12-28(2,3)11-20(33)26(23)25/h5-10,25H,11-12,14,30H2,1-4H3,(H,31,34)/t25-/m0/s1 |
| InChIKey | IPIXUQLSVRYJFY-VWLOTQADSA-N |
| XLogP | 4.38 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|