C22H17IN2O4S — CID 98121708
methyl (1S,9R,13E,16S)-13-[(3-iodophenyl)methylidene]-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxylate (PubChem CID 98121708) has the molecular formula C22H17IN2O4S and a molecular weight of 532.36 g/mol. Its IUPAC name is methyl (1S,9R,13E,16S)-13-[(3-iodophenyl)methylidene]-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxylate.
| Compound Name | methyl (1S,9R,13E,16S)-13-[(3-iodophenyl)methylidene]-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxylate |
|---|---|
| PubChem CID | 98121708 |
| Molecular Formula | C22H17IN2O4S |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | methyl (1S,9R,13E,16S)-13-[(3-iodophenyl)methylidene]-9-methyl-14-oxo-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraene-16-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2c3ccccc3O[C@@]1(C)N=c1s/c(=C/c3cccc(I)c3)c(=O)n12 |
| InChI | InChI=1S/C22H17IN2O4S/c1-22-17(20(27)28-2)18(14-8-3-4-9-15(14)29-22)25-19(26)16(30-21(25)24-22)11-12-6-5-7-13(23)10-12/h3-11,17-18H,1-2H3/b16-11+/t17-,18-,22-/m1/s1 |
| InChIKey | DASNBTKJDYFXCB-DURKPXIESA-N |
| XLogP | 2.46 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|