C26H16Cl4N2O6 — CID 98121953
2-[(2S,3R)-2-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 98121953) has the molecular formula C26H16Cl4N2O6 and a molecular weight of 594.23 g/mol. Its IUPAC name is 2-[(2S,3R)-2-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-[(2S,3R)-2-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 98121953 |
| Molecular Formula | C26H16Cl4N2O6 |
| Molecular Weight | 594.23 g/mol |
| Exact Mass | 591.98 |
| IUPAC Name | 2-[(2S,3R)-2-(1,3-benzodioxol-5-yl)-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)[C@H](N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)[C@@H]2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C26H16Cl4N2O6/c1-2-36-13-6-4-12(5-7-13)31-22(11-3-8-14-15(9-11)38-10-37-14)23(26(31)35)32-24(33)16-17(25(32)34)19(28)21(30)20(29)18(16)27/h3-9,22-23H,2,10H2,1H3/t22-,23+/m0/s1 |
| InChIKey | RPWRFHRDEGIJQZ-XZOQPEGZSA-N |
| XLogP | 6.18 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.23 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|