C20H34N2O2 — CID 98124476
(1S,4S)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98124476) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1S,4S)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4S)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98124476 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | (1S,4S)-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-4-yl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)CC(NC(=O)[C@@]23CC[C@](C)(C(=O)C2)C3(C)C)CC(C)(C)N1 |
| InChI | InChI=1S/C20H34N2O2/c1-16(2)10-13(11-17(3,4)22-16)21-15(24)20-9-8-19(7,14(23)12-20)18(20,5)6/h13,22H,8-12H2,1-7H3,(H,21,24)/t19-,20-/m1/s1 |
| InChIKey | ONQAYZAARFLCHV-WOJBJXKFSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |