(2R)-2-methylpentane-1-sulfonyl fluoride

C6H13FO2S — CID 98124567

IUPAC(2R)-2-methylpentane-1-sulfonyl fluoride
SMILESCCC[C@@H](C)CS(=O)(=O)F
InChIInChI=1S/C6H13FO2S/c1-3-4-6(2)5-10(7,8)9/h6H,3-5H2,1-2H3/t6-/m1/s1
InChIKeyRVEYUYIQKZYRJQ-ZCFIWIBFSA-N
MW168.23 g/mol
LogP1.72
Rot. Bonds4

About (2R)-2-methylpentane-1-sulfonyl fluoride

(2R)-2-methylpentane-1-sulfonyl fluoride (PubChem CID 98124567) has the molecular formula C6H13FO2S and a molecular weight of 168.23 g/mol. Its IUPAC name is (2R)-2-methylpentane-1-sulfonyl fluoride.

Molecular Properties

Compound Name(2R)-2-methylpentane-1-sulfonyl fluoride
PubChem CID98124567
Molecular FormulaC6H13FO2S
Molecular Weight168.23 g/mol
Exact Mass168.06
IUPAC Name(2R)-2-methylpentane-1-sulfonyl fluoride
SMILESCCC[C@@H](C)CS(=O)(=O)F
InChIInChI=1S/C6H13FO2S/c1-3-4-6(2)5-10(7,8)9/h6H,3-5H2,1-2H3/t6-/m1/s1
InChIKeyRVEYUYIQKZYRJQ-ZCFIWIBFSA-N
XLogP1.72
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.23
LogP ≤ 51.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2R)-2-methylpentane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-Methylpentane-1-sulfonyl chloride
CID 20532481
2-Methylbutane-1-sulfonyl fluoride
CID 22935853
4-Methylpentane-2-sulfonyl chloride
CID 54347504
2-Methylpentane-1-sulfonyl fluoride
CID 54593061
2-Methylpropane-1-sulfonyl fluoride
CID 56604709
Pentane-1-sulfonyl fluoride
CID 22935878
2-Ethylbutane-1-sulfonyl fluoride
CID 54593062
5-Methylhexane-2-sulfonyl chloride
CID 62084209
2,4-Dimethylpentane-1-sulfonyl chloride
CID 83637643
Pentane-3-sulfonyl fluoride
CID 122236127
(3,3-Dimethylcyclobutyl)methanesulfonyl fluoride
CID 138989254
(2-Methylcyclopropyl)methanesulfonyl fluoride
CID 139022381

Frequently Asked Questions

What is the IUPAC name of (2R)-2-methylpentane-1-sulfonyl fluoride?
The IUPAC name of (2R)-2-methylpentane-1-sulfonyl fluoride (CID 98124567) is (2R)-2-methylpentane-1-sulfonyl fluoride.
What is the SMILES notation for (2R)-2-methylpentane-1-sulfonyl fluoride?
The canonical SMILES for (2R)-2-methylpentane-1-sulfonyl fluoride is CCC[C@@H](C)CS(=O)(=O)F.
What is the InChIKey of (2R)-2-methylpentane-1-sulfonyl fluoride?
The InChIKey is RVEYUYIQKZYRJQ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H13FO2S/c1-3-4-6(2)5-10(7,8)9/h6H,3-5H2,1-2H3/t6-/m1/s1.
What are the key properties of (2R)-2-methylpentane-1-sulfonyl fluoride?
(2R)-2-methylpentane-1-sulfonyl fluoride has a molecular weight of 168.23 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylpentane-1-sulfonyl fluoride is sourced from PubChem (CID 98124567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).