C6H10ClNO2S — CID 98125096
(1S,4S)-2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride (PubChem CID 98125096) has the molecular formula C6H10ClNO2S and a molecular weight of 195.67 g/mol. Its IUPAC name is (1S,4S)-2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride.
| Compound Name | (1S,4S)-2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride |
|---|---|
| PubChem CID | 98125096 |
| Molecular Formula | C6H10ClNO2S |
| Molecular Weight | 195.67 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | (1S,4S)-2-azabicyclo[2.2.1]heptane-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)N1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C6H10ClNO2S/c7-11(9,10)8-4-5-1-2-6(8)3-5/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | JTJDUIZFCHPANH-WDSKDSINSA-N |
| XLogP | 0.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.67 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |