C11H7F3O — CID 98125559
(1S,8S)-4-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 98125559) has the molecular formula C11H7F3O and a molecular weight of 212.17 g/mol. Its IUPAC name is (1S,8S)-4-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | (1S,8S)-4-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 98125559 |
| Molecular Formula | C11H7F3O |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (1S,8S)-4-(trifluoromethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C11H7F3O/c12-11(13,14)6-1-2-7-8(5-6)10-4-3-9(7)15-10/h1-5,9-10H/t9-,10-/m0/s1 |
| InChIKey | DVUOBDNEIQEEHF-UWVGGRQHSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|