C14H22O — CID 98125613
(2R,6S,7R)-1,7-dimethyl-7-(2-methylprop-1-enoxymethyl)tricyclo[2.2.1.02,6]heptane (PubChem CID 98125613) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (2R,6S,7R)-1,7-dimethyl-7-(2-methylprop-1-enoxymethyl)tricyclo[2.2.1.02,6]heptane.
| Compound Name | (2R,6S,7R)-1,7-dimethyl-7-(2-methylprop-1-enoxymethyl)tricyclo[2.2.1.02,6]heptane |
|---|---|
| PubChem CID | 98125613 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (2R,6S,7R)-1,7-dimethyl-7-(2-methylprop-1-enoxymethyl)tricyclo[2.2.1.02,6]heptane |
| SMILES | CC(C)=COC[C@]1(C)C2C[C@@H]3[C@H](C2)C31C |
| InChI | InChI=1S/C14H22O/c1-9(2)7-15-8-13(3)10-5-11-12(6-10)14(11,13)4/h7,10-12H,5-6,8H2,1-4H3/t10?,11-,12+,13-,14?/m1/s1 |
| InChIKey | RYJUGUBHNQVNHA-ANNIKCPVSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|