About 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole
2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole (PubChem CID 98127443) has the molecular formula C18H15Cl2N3O3
and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole |
| PubChem CID | 98127443 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1cccc(/C=C(\OC(CCl)CCl)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C18H15Cl2N3O3/c19-10-14(11-20)26-17(9-12-4-3-5-13(8-12)23(24)25)18-21-15-6-1-2-7-16(15)22-18/h1-9,14H,10-11H2,(H,21,22)/b17-9- |
| InChIKey | JNMHLGNLYDZESN-MFOYZWKCSA-N |
| XLogP | 4.83 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole?
The IUPAC name of 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole (CID 98127443) is 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole.
What is the SMILES notation for 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole?
The canonical SMILES for 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole is O=[N+]([O-])c1cccc(/C=C(\OC(CCl)CCl)c2nc3ccccc3[nH]2)c1.
What is the InChIKey of 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole?
The InChIKey is JNMHLGNLYDZESN-MFOYZWKCSA-N. The full InChI is InChI=1S/C18H15Cl2N3O3/c19-10-14(11-20)26-17(9-12-4-3-5-13(8-12)23(24)25)18-21-15-6-1-2-7-16(15)22-18/h1-9,14H,10-11H2,(H,21,22)/b17-9-.
What are the key properties of 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole?
2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole has a molecular weight of 392.24 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-1-(1,3-dichloropropan-2-yloxy)-2-(3-nitrophenyl)ethenyl]-1H-benzimidazole is sourced from PubChem (CID 98127443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).