C24H34N2O3 — CID 98127607
N,N-dicyclohexyl-3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanamide (PubChem CID 98127607) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is N,N-dicyclohexyl-3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanamide.
| Compound Name | N,N-dicyclohexyl-3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanamide |
|---|---|
| PubChem CID | 98127607 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | N,N-dicyclohexyl-3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanamide |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1CCC(=O)N(C1CCCCC1)C1CCCCC1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C24H34N2O3/c27-20(26(18-7-3-1-4-8-18)19-9-5-2-6-10-19)13-14-25-23(28)21-16-11-12-17(15-16)22(21)24(25)29/h11-12,16-19,21-22H,1-10,13-15H2/t16-,17-,21-,22+/m0/s1 |
| InChIKey | PCZTXKYXZUXLDA-KLDKWKSESA-N |
| XLogP | 3.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|