C18H20N6O7 — CID 98127893
2-[(3aR,6E,7aS)-6-[(3,5-dinitrophenyl)hydrazinylidene]-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide (PubChem CID 98127893) has the molecular formula C18H20N6O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-[(3aR,6E,7aS)-6-[(3,5-dinitrophenyl)hydrazinylidene]-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aR,6E,7aS)-6-[(3,5-dinitrophenyl)hydrazinylidene]-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 98127893 |
| Molecular Formula | C18H20N6O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[(3aR,6E,7aS)-6-[(3,5-dinitrophenyl)hydrazinylidene]-1,3-dioxo-4,5,7,7a-tetrahydro-3aH-isoindol-2-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=O)[C@H]2C/C(=N/Nc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC[C@H]2C1=O |
| InChI | InChI=1S/C18H20N6O7/c1-21(2)16(25)9-22-17(26)14-4-3-10(7-15(14)18(22)27)19-20-11-5-12(23(28)29)8-13(6-11)24(30)31/h5-6,8,14-15,20H,3-4,7,9H2,1-2H3/b19-10+/t14-,15+/m1/s1 |
| InChIKey | DTYUAJBTVHJMOI-LILRULDKSA-N |
| XLogP | 1.14 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|