C28H35N5 — CID 98127997
2-[(1R,6S,20R)-17-(cyclohexylamino)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,17-trien-19-ylidene]propanedinitrile (PubChem CID 98127997) has the molecular formula C28H35N5 and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-[(1R,6S,20R)-17-(cyclohexylamino)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,17-trien-19-ylidene]propanedinitrile.
| Compound Name | 2-[(1R,6S,20R)-17-(cyclohexylamino)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,17-trien-19-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 98127997 |
| Molecular Formula | C28H35N5 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 2-[(1R,6S,20R)-17-(cyclohexylamino)-14,21-diazapentacyclo[12.7.0.01,6.08,13.015,20]henicosa-8(13),15,17-trien-19-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C(NC2CCCCC2)C=C2[C@@H]1N[C@@]13CCCC[C@H]1CC1=C(CCCC1)N23 |
| InChI | InChI=1S/C28H35N5/c29-17-20(18-30)24-15-23(31-22-10-2-1-3-11-22)16-26-27(24)32-28-13-7-6-9-21(28)14-19-8-4-5-12-25(19)33(26)28/h15-16,21-22,27,31-32H,1-14H2/t21-,27+,28+/m0/s1 |
| InChIKey | WUJKFZSNKZMUFF-GJJMEYSYSA-N |
| XLogP | 5.43 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|