C17H27ClO2 — CID 98128536
(2S,4S)-4-(chloromethyl)-2-[(2S,3S)-3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]-1,3-dioxolane (PubChem CID 98128536) has the molecular formula C17H27ClO2 and a molecular weight of 298.85 g/mol. Its IUPAC name is (2S,4S)-4-(chloromethyl)-2-[(2S,3S)-3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]-1,3-dioxolane.
| Compound Name | (2S,4S)-4-(chloromethyl)-2-[(2S,3S)-3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 98128536 |
| Molecular Formula | C17H27ClO2 |
| Molecular Weight | 298.85 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2S,4S)-4-(chloromethyl)-2-[(2S,3S)-3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]-1,3-dioxolane |
| SMILES | C[C@H]1CC2=C(C[C@@H]1[C@H]1OC[C@@H](CCl)O1)C(C)(C)CCC2 |
| InChI | InChI=1S/C17H27ClO2/c1-11-7-12-5-4-6-17(2,3)15(12)8-14(11)16-19-10-13(9-18)20-16/h11,13-14,16H,4-10H2,1-3H3/t11-,13+,14-,16-/m0/s1 |
| InChIKey | AZJNNJNKFBVVJR-AEIGPULVSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|