C29H28N4O5 — CID 98128693
2-[2-[4-[2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]piperazin-1-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 98128693) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-[2-[4-[2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]piperazin-1-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[4-[2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]piperazin-1-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 98128693 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-[2-[4-[2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]piperazin-1-yl]-2-oxoethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C(CN1C(=O)c2cccc3cccc(c23)C1=O)N1CCN(CCN2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2C=C[C@H]3C2)CC1 |
| InChI | InChI=1S/C29H28N4O5/c34-22(16-33-26(35)20-5-1-3-17-4-2-6-21(23(17)20)27(33)36)31-12-9-30(10-13-31)11-14-32-28(37)24-18-7-8-19(15-18)25(24)29(32)38/h1-8,18-19,24-25H,9-16H2/t18-,19-,24-,25-/m0/s1 |
| InChIKey | XTDHEOGJUOXHII-CWGXUGAXSA-N |
| XLogP | 1.39 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|