C32H41NO7 — CID 98128745
(5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione (PubChem CID 98128745) has the molecular formula C32H41NO7 and a molecular weight of 551.68 g/mol. Its IUPAC name is (5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98128745 |
| Molecular Formula | C32H41NO7 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | (5S)-4-[(4-butoxyphenyl)-hydroxymethylidene]-5-(3-methoxy-4-pentoxyphenyl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc([C@H]2C(=C(O)c3ccc(OCCCC)cc3)C(=O)C(=O)N2C[C@@H]2CCCO2)cc1OC |
| InChI | InChI=1S/C32H41NO7/c1-4-6-8-18-40-26-16-13-23(20-27(26)37-3)29-28(31(35)32(36)33(29)21-25-10-9-19-39-25)30(34)22-11-14-24(15-12-22)38-17-7-5-2/h11-16,20,25,29,34H,4-10,17-19,21H2,1-3H3/t25-,29-/m0/s1 |
| InChIKey | FEJGBVKJWZSKFN-SVEHJYQDSA-N |
| XLogP | 6.04 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|