C31H49NO — CID 98129669
(2S)-1-(diheptylamino)-3-(1,2,3,4-tetrahydrophenanthren-9-yl)propan-2-ol (PubChem CID 98129669) has the molecular formula C31H49NO and a molecular weight of 451.74 g/mol. Its IUPAC name is (2S)-1-(diheptylamino)-3-(1,2,3,4-tetrahydrophenanthren-9-yl)propan-2-ol.
| Compound Name | (2S)-1-(diheptylamino)-3-(1,2,3,4-tetrahydrophenanthren-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 98129669 |
| Molecular Formula | C31H49NO |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | (2S)-1-(diheptylamino)-3-(1,2,3,4-tetrahydrophenanthren-9-yl)propan-2-ol |
| SMILES | CCCCCCCN(CCCCCCC)C[C@@H](O)Cc1cc2c(c3ccccc13)CCCC2 |
| InChI | InChI=1S/C31H49NO/c1-3-5-7-9-15-21-32(22-16-10-8-6-4-2)25-28(33)24-27-23-26-17-11-12-18-29(26)31-20-14-13-19-30(27)31/h13-14,19-20,23,28,33H,3-12,15-18,21-22,24-25H2,1-2H3/t28-/m0/s1 |
| InChIKey | OORJLRQDUGODDN-NDEPHWFRSA-N |
| XLogP | 7.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|