About [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene
[[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene (PubChem CID 98130022) has the molecular formula C19H23O2P
and a molecular weight of 314.37 g/mol. Its IUPAC name is [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene.
Molecular Properties
| Compound Name | [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene |
| PubChem CID | 98130022 |
| Molecular Formula | C19H23O2P |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene |
| SMILES | C[C@H]1CCCC[C@@H]1OP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23O2P/c1-16-10-8-9-15-19(16)21-22(20,17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-7,11-14,16,19H,8-10,15H2,1H3/t16-,19-/m0/s1 |
| InChIKey | NZVFXIIZKAIPKD-LPHOPBHVSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene?
The IUPAC name of [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene (CID 98130022) is [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene.
What is the SMILES notation for [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene?
The canonical SMILES for [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene is C[C@H]1CCCC[C@@H]1OP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene?
The InChIKey is NZVFXIIZKAIPKD-LPHOPBHVSA-N. The full InChI is InChI=1S/C19H23O2P/c1-16-10-8-9-15-19(16)21-22(20,17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-7,11-14,16,19H,8-10,15H2,1H3/t16-,19-/m0/s1.
What are the key properties of [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene?
[[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene has a molecular weight of 314.37 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1S,2S)-2-methylcyclohexyl]oxy-phenylphosphoryl]benzene is sourced from PubChem (CID 98130022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).