C17H30NO3P — CID 98130579
[(S)-(decylamino)-phenylmethyl]phosphonic acid (PubChem CID 98130579) has the molecular formula C17H30NO3P and a molecular weight of 327.40 g/mol. Its IUPAC name is [(S)-(decylamino)-phenylmethyl]phosphonic acid.
| Compound Name | [(S)-(decylamino)-phenylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 98130579 |
| Molecular Formula | C17H30NO3P |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | [(S)-(decylamino)-phenylmethyl]phosphonic acid |
| SMILES | CCCCCCCCCCN[C@H](c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C17H30NO3P/c1-2-3-4-5-6-7-8-12-15-18-17(22(19,20)21)16-13-10-9-11-14-16/h9-11,13-14,17-18H,2-8,12,15H2,1H3,(H2,19,20,21)/t17-/m0/s1 |
| InChIKey | JRUCEIRKFMFRKI-KRWDZBQOSA-N |
| XLogP | 4.59 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|