C20H18N2O5 — CID 98130677
[(Z)-[(1R,2S,7S,8R)-4-methyl-6-oxo-3-tricyclo[6.2.2.02,7]dodeca-4,9-dienylidene]amino] 3-nitrobenzoate (PubChem CID 98130677) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(Z)-[(1R,2S,7S,8R)-4-methyl-6-oxo-3-tricyclo[6.2.2.02,7]dodeca-4,9-dienylidene]amino] 3-nitrobenzoate.
| Compound Name | [(Z)-[(1R,2S,7S,8R)-4-methyl-6-oxo-3-tricyclo[6.2.2.02,7]dodeca-4,9-dienylidene]amino] 3-nitrobenzoate |
|---|---|
| PubChem CID | 98130677 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [(Z)-[(1R,2S,7S,8R)-4-methyl-6-oxo-3-tricyclo[6.2.2.02,7]dodeca-4,9-dienylidene]amino] 3-nitrobenzoate |
| SMILES | CC1=CC(=O)[C@@H]2[C@@H](/C1=N/OC(=O)c1cccc([N+](=O)[O-])c1)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C20H18N2O5/c1-11-9-16(23)17-12-5-7-13(8-6-12)18(17)19(11)21-27-20(24)14-3-2-4-15(10-14)22(25)26/h2-5,7,9-10,12-13,17-18H,6,8H2,1H3/b21-19+/t12-,13-,17+,18-/m0/s1 |
| InChIKey | QLAPPSIXOBEVQR-GBJFQZSOSA-N |
| XLogP | 3.46 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|