C15H20Cl2O2 — CID 98130752
(1R,6R)-1,4-ditert-butyl-7,7-dichlorobicyclo[4.1.0]hept-4-ene-2,3-dione (PubChem CID 98130752) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is (1R,6R)-1,4-ditert-butyl-7,7-dichlorobicyclo[4.1.0]hept-4-ene-2,3-dione.
| Compound Name | (1R,6R)-1,4-ditert-butyl-7,7-dichlorobicyclo[4.1.0]hept-4-ene-2,3-dione |
|---|---|
| PubChem CID | 98130752 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (1R,6R)-1,4-ditert-butyl-7,7-dichlorobicyclo[4.1.0]hept-4-ene-2,3-dione |
| SMILES | CC(C)(C)C1=C[C@H]2C(Cl)(Cl)[C@]2(C(C)(C)C)C(=O)C1=O |
| InChI | InChI=1S/C15H20Cl2O2/c1-12(2,3)8-7-9-14(13(4,5)6,15(9,16)17)11(19)10(8)18/h7,9H,1-6H3/t9-,14+/m1/s1 |
| InChIKey | CUYKXWJBOVMRHB-OTYXRUKQSA-N |
| XLogP | 3.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|