C10H13IO3 — CID 98131243
(1R,2S,3R,6S,7S,10R)-10-(hydroxymethyl)-2-iodo-4-oxatricyclo[4.3.1.03,7]decan-5-one (PubChem CID 98131243) has the molecular formula C10H13IO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is (1R,2S,3R,6S,7S,10R)-10-(hydroxymethyl)-2-iodo-4-oxatricyclo[4.3.1.03,7]decan-5-one.
| Compound Name | (1R,2S,3R,6S,7S,10R)-10-(hydroxymethyl)-2-iodo-4-oxatricyclo[4.3.1.03,7]decan-5-one |
|---|---|
| PubChem CID | 98131243 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (1R,2S,3R,6S,7S,10R)-10-(hydroxymethyl)-2-iodo-4-oxatricyclo[4.3.1.03,7]decan-5-one |
| SMILES | O=C1O[C@H]2[C@@H](I)[C@@H]3CC[C@H]2[C@@H]1[C@H]3CO |
| InChI | InChI=1S/C10H13IO3/c11-8-4-1-2-5-7(6(4)3-12)10(13)14-9(5)8/h4-9,12H,1-3H2/t4-,5+,6+,7-,8+,9-/m1/s1 |
| InChIKey | REXUMYWXJZUFHW-HLUDCIRASA-N |
| XLogP | 0.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|