C5H7N7 — CID 98132225
(3aR)-3aH-pyrazolo[3,4-d]pyrimidine-3,4,6-triamine (PubChem CID 98132225) has the molecular formula C5H7N7 and a molecular weight of 165.16 g/mol. Its IUPAC name is (3aR)-3aH-pyrazolo[3,4-d]pyrimidine-3,4,6-triamine.
| Compound Name | (3aR)-3aH-pyrazolo[3,4-d]pyrimidine-3,4,6-triamine |
|---|---|
| PubChem CID | 98132225 |
| Molecular Formula | C5H7N7 |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (3aR)-3aH-pyrazolo[3,4-d]pyrimidine-3,4,6-triamine |
| SMILES | NC1=NC2=NN=C(N)[C@H]2C(N)=N1 |
| InChI | InChI=1S/C5H7N7/c6-2-1-3(7)11-12-4(1)10-5(8)9-2/h1H,(H2,7,11)(H4,6,8,9,10,12)/t1-/m1/s1 |
| InChIKey | LMXMXXHXTCYUAU-PVQJCKRUSA-N |
| XLogP | -2.03 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |