C24H31N5O3 — CID 98132450
11-propanoyl-5-[1-[(2S)-spiro[2.3]hexane-2-carbonyl]piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 98132450) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 11-propanoyl-5-[1-[(2S)-spiro[2.3]hexane-2-carbonyl]piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-propanoyl-5-[1-[(2S)-spiro[2.3]hexane-2-carbonyl]piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 98132450 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 11-propanoyl-5-[1-[(2S)-spiro[2.3]hexane-2-carbonyl]piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCC(=O)N1CCc2nc3cc(C4CCN(C(=O)[C@H]5CC56CCC6)CC4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C24H31N5O3/c1-2-21(30)28-11-6-18-16(14-28)22(31)29-20(25-18)12-19(26-29)15-4-9-27(10-5-15)23(32)17-13-24(17)7-3-8-24/h12,15,17,26H,2-11,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | VZWWWTCEBFGQJJ-QGZVFWFLSA-N |
| XLogP | 2.21 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |