C26H34N4O — CID 98133702
2-[(1R)-cyclopent-2-en-1-yl]-N-[[4-(2-propan-2-yl-5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]acetamide (PubChem CID 98133702) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-N-[[4-(2-propan-2-yl-5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]acetamide.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[4-(2-propan-2-yl-5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 98133702 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-N-[[4-(2-propan-2-yl-5-pyridin-4-ylpyrimidin-4-yl)cyclohexyl]methyl]acetamide |
| SMILES | CC(C)c1ncc(-c2ccncc2)c(C2CCC(CNC(=O)C[C@@H]3C=CCC3)CC2)n1 |
| InChI | InChI=1S/C26H34N4O/c1-18(2)26-29-17-23(21-11-13-27-14-12-21)25(30-26)22-9-7-20(8-10-22)16-28-24(31)15-19-5-3-4-6-19/h3,5,11-14,17-20,22H,4,6-10,15-16H2,1-2H3,(H,28,31)/t19-,20?,22?/m1/s1 |
| InChIKey | JQYNDBPUWAMTQW-VRKFHHGPSA-N |
| XLogP | 5.41 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|