C24H28N4O — CID 98134976
2-(4-methylphenyl)-N-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)cyclohexyl]methyl]acetamide (PubChem CID 98134976) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)cyclohexyl]methyl]acetamide.
| Compound Name | 2-(4-methylphenyl)-N-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)cyclohexyl]methyl]acetamide |
|---|---|
| PubChem CID | 98134976 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-(4-methylphenyl)-N-[[4-(4-pyridin-4-yl-1H-pyrazol-5-yl)cyclohexyl]methyl]acetamide |
| SMILES | Cc1ccc(CC(=O)NCC2CCC(c3[nH]ncc3-c3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O/c1-17-2-4-18(5-3-17)14-23(29)26-15-19-6-8-21(9-7-19)24-22(16-27-28-24)20-10-12-25-13-11-20/h2-5,10-13,16,19,21H,6-9,14-15H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | WHYGDJNWNLUUJO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |