C11H14Br2O3 — CID 98135264
(1S,2S,4R)-2-bromo-4-(bromomethyl)-7,7-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 98135264) has the molecular formula C11H14Br2O3 and a molecular weight of 354.04 g/mol. Its IUPAC name is (1S,2S,4R)-2-bromo-4-(bromomethyl)-7,7-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (1S,2S,4R)-2-bromo-4-(bromomethyl)-7,7-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 98135264 |
| Molecular Formula | C11H14Br2O3 |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | (1S,2S,4R)-2-bromo-4-(bromomethyl)-7,7-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC1(C)[C@]2(CBr)CC[C@]1(C(=O)O)[C@H](Br)C2=O |
| InChI | InChI=1S/C11H14Br2O3/c1-9(2)10(5-12)3-4-11(9,8(15)16)6(13)7(10)14/h6H,3-5H2,1-2H3,(H,15,16)/t6-,10+,11-/m1/s1 |
| InChIKey | MFQZVXXGEBQQQI-LIEZGIJOSA-N |
| XLogP | 2.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|