C13H15F3N2S — CID 98135495
(1S,8S)-1,11,11-trimethyl-6-(trifluoromethyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-diene-4-thione (PubChem CID 98135495) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is (1S,8S)-1,11,11-trimethyl-6-(trifluoromethyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-diene-4-thione.
| Compound Name | (1S,8S)-1,11,11-trimethyl-6-(trifluoromethyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-diene-4-thione |
|---|---|
| PubChem CID | 98135495 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (1S,8S)-1,11,11-trimethyl-6-(trifluoromethyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-diene-4-thione |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)c1[nH]c(=S)nc(C(F)(F)F)c12 |
| InChI | InChI=1S/C13H15F3N2S/c1-11(2)6-4-5-12(11,3)8-7(6)9(13(14,15)16)18-10(19)17-8/h6H,4-5H2,1-3H3,(H,17,18,19)/t6-,12-/m1/s1 |
| InChIKey | FMPXSYUWRRBPDK-SREIQFSDSA-N |
| XLogP | 4.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|