C16H15NO5 — CID 98135507
(1S,2R,3R,4S)-3-[(3-acetylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98135507) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[(3-acetylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-[(3-acetylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98135507 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (1S,2R,3R,4S)-3-[(3-acetylphenyl)carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H]2[C@@H](C(=O)O)[C@@H]3C=C[C@@H]2O3)c1 |
| InChI | InChI=1S/C16H15NO5/c1-8(18)9-3-2-4-10(7-9)17-15(19)13-11-5-6-12(22-11)14(13)16(20)21/h2-7,11-14H,1H3,(H,17,19)(H,20,21)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | AZERMEIHQZCSDJ-XUXIUFHCSA-N |
| XLogP | 1.48 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|