C19H27NO3 — CID 98135631
(1S,2S,5S,6S,10R,12S,14S)-14-methyl-9-methylidene-5-(pyrrolidin-1-ylmethyl)-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one (PubChem CID 98135631) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (1S,2S,5S,6S,10R,12S,14S)-14-methyl-9-methylidene-5-(pyrrolidin-1-ylmethyl)-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one.
| Compound Name | (1S,2S,5S,6S,10R,12S,14S)-14-methyl-9-methylidene-5-(pyrrolidin-1-ylmethyl)-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
|---|---|
| PubChem CID | 98135631 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (1S,2S,5S,6S,10R,12S,14S)-14-methyl-9-methylidene-5-(pyrrolidin-1-ylmethyl)-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradecan-4-one |
| SMILES | C=C1CC[C@@H]2[C@H](OC(=O)[C@@H]2CN2CCCC2)[C@@H]2[C@H]1C[C@@H]1O[C@@]21C |
| InChI | InChI=1S/C19H27NO3/c1-11-5-6-12-14(10-20-7-3-4-8-20)18(21)22-17(12)16-13(11)9-15-19(16,2)23-15/h12-17H,1,3-10H2,2H3/t12-,13-,14+,15-,16-,17-,19+/m0/s1 |
| InChIKey | UDAYTDZCASOPOV-QLDKNCGGSA-N |
| XLogP | 2.38 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|