C22H33NO — CID 98135780
(1S,2Z,5R)-6,6-dimethyl-2-[1-[[(1S)-1-[(1S,3S,6R,7R,8S)-7-tricyclo[4.3.1.03,8]decanyl]ethyl]amino]ethylidene]bicyclo[3.1.0]hexan-3-one (PubChem CID 98135780) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (1S,2Z,5R)-6,6-dimethyl-2-[1-[[(1S)-1-[(1S,3S,6R,7R,8S)-7-tricyclo[4.3.1.03,8]decanyl]ethyl]amino]ethylidene]bicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,2Z,5R)-6,6-dimethyl-2-[1-[[(1S)-1-[(1S,3S,6R,7R,8S)-7-tricyclo[4.3.1.03,8]decanyl]ethyl]amino]ethylidene]bicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 98135780 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (1S,2Z,5R)-6,6-dimethyl-2-[1-[[(1S)-1-[(1S,3S,6R,7R,8S)-7-tricyclo[4.3.1.03,8]decanyl]ethyl]amino]ethylidene]bicyclo[3.1.0]hexan-3-one |
| SMILES | C/C(N[C@@H](C)[C@@H]1[C@@H]2CC[C@H]3C[C@@H](C2)C[C@@H]31)=C1/C(=O)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C22H33NO/c1-11(19-15-6-5-14-7-13(8-15)9-16(14)19)23-12(2)20-18(24)10-17-21(20)22(17,3)4/h11,13-17,19,21,23H,5-10H2,1-4H3/b20-12+/t11-,13-,14-,15+,16-,17+,19+,21+/m0/s1 |
| InChIKey | FTBDZFXCBOAPHD-KPPJZBSQSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|