C18H19BrO5 — CID 98136866
methyl (1S,5R,6R)-6-(4-bromobenzoyl)-6-ethyl-4,4-dimethyl-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 98136866) has the molecular formula C18H19BrO5 and a molecular weight of 395.25 g/mol. Its IUPAC name is methyl (1S,5R,6R)-6-(4-bromobenzoyl)-6-ethyl-4,4-dimethyl-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1S,5R,6R)-6-(4-bromobenzoyl)-6-ethyl-4,4-dimethyl-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 98136866 |
| Molecular Formula | C18H19BrO5 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | methyl (1S,5R,6R)-6-(4-bromobenzoyl)-6-ethyl-4,4-dimethyl-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CC[C@@]1(C(=O)c2ccc(Br)cc2)[C@H]2C(C)(C)OC(=O)[C@@]21C(=O)OC |
| InChI | InChI=1S/C18H19BrO5/c1-5-17(12(20)10-6-8-11(19)9-7-10)13-16(2,3)24-15(22)18(13,17)14(21)23-4/h6-9,13H,5H2,1-4H3/t13-,17-,18+/m1/s1 |
| InChIKey | ZQBHEMWHIYVAQM-XWIAVFTESA-N |
| XLogP | 3.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|