C9H14N4O — CID 98136905
2-[(Z)-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-1-hydroxyguanidine (PubChem CID 98136905) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-[(Z)-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-1-hydroxyguanidine.
| Compound Name | 2-[(Z)-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 98136905 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-[(Z)-[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methylideneamino]-1-hydroxyguanidine |
| SMILES | NC(=N/N=C\[C@H]1C[C@@H]2C=C[C@@H]1C2)NO |
| InChI | InChI=1S/C9H14N4O/c10-9(13-14)12-11-5-8-4-6-1-2-7(8)3-6/h1-2,5-8,14H,3-4H2,(H3,10,12,13)/b11-5-/t6-,7-,8-/m1/s1 |
| InChIKey | KFYIYNIBTQVYJF-CFAVNADVSA-N |
| XLogP | 0.48 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|