C20H20F2N2O2 — CID 98137879
(2-fluorophenyl)-[(1R,5R)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]methanone (PubChem CID 98137879) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2-fluorophenyl)-[(1R,5R)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]methanone.
| Compound Name | (2-fluorophenyl)-[(1R,5R)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]methanone |
|---|---|
| PubChem CID | 98137879 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2-fluorophenyl)-[(1R,5R)-9-(2-fluoro-3-pyridinyl)-9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl]methanone |
| SMILES | O=C(c1ccccc1F)N1C[C@H]2CCC[C@H](C1)C2(O)c1cccnc1F |
| InChI | InChI=1S/C20H20F2N2O2/c21-17-9-2-1-7-15(17)19(25)24-11-13-5-3-6-14(12-24)20(13,26)16-8-4-10-23-18(16)22/h1-2,4,7-10,13-14,26H,3,5-6,11-12H2/t13-,14-/m1/s1 |
| InChIKey | YMSJWVOSRDGPLS-ZIAGYGMSSA-N |
| XLogP | 3.12 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|