C21H25N5O4 — CID 98139412
2-[(5R)-1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]acetamide (PubChem CID 98139412) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[(5R)-1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[(5R)-1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 98139412 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-[(5R)-1,3-dimethyl-2,4,6-trioxo-5,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl]-N-[(2-pyrrolidin-1-ylphenyl)methyl]acetamide |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@@H](CC(=O)NCc1ccccc1N1CCCC1)C(=O)N2 |
| InChI | InChI=1S/C21H25N5O4/c1-24-18-17(20(29)25(2)21(24)30)14(19(28)23-18)11-16(27)22-12-13-7-3-4-8-15(13)26-9-5-6-10-26/h3-4,7-8,14H,5-6,9-12H2,1-2H3,(H,22,27)(H,23,28)/t14-/m1/s1 |
| InChIKey | KNDJIMGXHFZMCN-CQSZACIVSA-N |
| XLogP | 0.43 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |