C24H31NO5 — CID 98140386
methyl 2-[7-hydroxy-4-methyl-2-oxo-8-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]chromen-3-yl]acetate (PubChem CID 98140386) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is methyl 2-[7-hydroxy-4-methyl-2-oxo-8-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]chromen-3-yl]acetate.
| Compound Name | methyl 2-[7-hydroxy-4-methyl-2-oxo-8-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]chromen-3-yl]acetate |
|---|---|
| PubChem CID | 98140386 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | methyl 2-[7-hydroxy-4-methyl-2-oxo-8-[[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]methyl]chromen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c2ccc(O)c(CN3C[C@]4(C)C[C@@H]3CC(C)(C)C4)c2oc1=O |
| InChI | InChI=1S/C24H31NO5/c1-14-16-6-7-19(26)18(21(16)30-22(28)17(14)8-20(27)29-5)11-25-13-24(4)10-15(25)9-23(2,3)12-24/h6-7,15,26H,8-13H2,1-5H3/t15-,24+/m0/s1 |
| InChIKey | FMZMZERQRMDNSC-IZHWHUGBSA-N |
| XLogP | 3.92 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|