C17H17NO4 — CID 98140554
(1S,2R,3R,4S)-3-(2,3-dihydro-1H-inden-5-ylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98140554) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-(2,3-dihydro-1H-inden-5-ylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-(2,3-dihydro-1H-inden-5-ylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98140554 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (1S,2R,3R,4S)-3-(2,3-dihydro-1H-inden-5-ylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](C(=O)Nc2ccc3c(c2)CCC3)[C@@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C17H17NO4/c19-16(14-12-6-7-13(22-12)15(14)17(20)21)18-11-5-4-9-2-1-3-10(9)8-11/h4-8,12-15H,1-3H2,(H,18,19)(H,20,21)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | MDZGXPLSYJJQDG-AJNGGQMLSA-N |
| XLogP | 1.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|