C30H23F2N3O2S — CID 98141950
(5R,7S,9E)-5-(4-fluorophenyl)-9-[(4-fluorophenyl)methylidene]-7-methyl-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline (PubChem CID 98141950) has the molecular formula C30H23F2N3O2S and a molecular weight of 527.60 g/mol. Its IUPAC name is (5R,7S,9E)-5-(4-fluorophenyl)-9-[(4-fluorophenyl)methylidene]-7-methyl-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline.
| Compound Name | (5R,7S,9E)-5-(4-fluorophenyl)-9-[(4-fluorophenyl)methylidene]-7-methyl-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
|---|---|
| PubChem CID | 98141950 |
| Molecular Formula | C30H23F2N3O2S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | (5R,7S,9E)-5-(4-fluorophenyl)-9-[(4-fluorophenyl)methylidene]-7-methyl-3-(3-nitrophenyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
| SMILES | C[C@@H]1CC2=C(N=C3SC=C(c4cccc([N+](=O)[O-])c4)N3[C@@H]2c2ccc(F)cc2)/C(=C/c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C30H23F2N3O2S/c1-18-13-22(15-19-5-9-23(31)10-6-19)28-26(14-18)29(20-7-11-24(32)12-8-20)34-27(17-38-30(34)33-28)21-3-2-4-25(16-21)35(36)37/h2-12,15-18,29H,13-14H2,1H3/b22-15+/t18-,29+/m0/s1 |
| InChIKey | GWLCTGUEUKEYNQ-HHKZHTPISA-N |
| XLogP | 8.10 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|