C19H24BrNO2 — CID 98142899
(1S,2S,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98142899) has the molecular formula C19H24BrNO2 and a molecular weight of 378.31 g/mol. Its IUPAC name is (1S,2S,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,2S,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98142899 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (1S,2S,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2-phenylethyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@]2(C(=O)NCCc3ccccc3)CC[C@]1(C)C(=O)[C@H]2Br |
| InChI | InChI=1S/C19H24BrNO2/c1-17(2)18(3)10-11-19(17,14(20)15(18)22)16(23)21-12-9-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,21,23)/t14-,18-,19-/m1/s1 |
| InChIKey | NTRRARPDJGNCRG-NIKGAXFTSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|