C18H22BrNO2 — CID 98142933
[(Z)-[(1R,4S,7S)-7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate (PubChem CID 98142933) has the molecular formula C18H22BrNO2 and a molecular weight of 364.28 g/mol. Its IUPAC name is [(Z)-[(1R,4S,7S)-7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate.
| Compound Name | [(Z)-[(1R,4S,7S)-7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 98142933 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [(Z)-[(1R,4S,7S)-7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C2/C[C@@H]3CC[C@]2(C)[C@@]3(C)CBr)cc1 |
| InChI | InChI=1S/C18H22BrNO2/c1-12-4-6-13(7-5-12)16(21)22-20-15-10-14-8-9-17(15,2)18(14,3)11-19/h4-7,14H,8-11H2,1-3H3/b20-15-/t14-,17-,18-/m0/s1 |
| InChIKey | IVRFJQZRXBWLSP-NTULXRODSA-N |
| XLogP | 4.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|