C30H31N3O4S2 — CID 98143817
prop-2-enyl (2Z,5S)-2-(1-heptyl-2-oxoindol-3-ylidene)-7-methyl-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98143817) has the molecular formula C30H31N3O4S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is prop-2-enyl (2Z,5S)-2-(1-heptyl-2-oxoindol-3-ylidene)-7-methyl-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl (2Z,5S)-2-(1-heptyl-2-oxoindol-3-ylidene)-7-methyl-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98143817 |
| Molecular Formula | C30H31N3O4S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | prop-2-enyl (2Z,5S)-2-(1-heptyl-2-oxoindol-3-ylidene)-7-methyl-3-oxo-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=c2s/c(=C3\C(=O)N(CCCCCCC)c4ccccc43)c(=O)n2[C@@H]1c1cccs1 |
| InChI | InChI=1S/C30H31N3O4S2/c1-4-6-7-8-11-16-32-21-14-10-9-13-20(21)24(27(32)34)26-28(35)33-25(22-15-12-18-38-22)23(29(36)37-17-5-2)19(3)31-30(33)39-26/h5,9-10,12-15,18,25H,2,4,6-8,11,16-17H2,1,3H3/b26-24-/t25-/m1/s1 |
| InChIKey | SHOKDGHSQDMRJF-ZCCPQQFYSA-N |
| XLogP | 4.71 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|