C26H23Cl3N4O3S — CID 98144181
methyl (3R)-4-(4-methoxyphenyl)-5-[N-(4-methylphenyl)-C-phenylcarbonimidoyl]imino-3-(trichloromethyl)-1,2,4-thiadiazolidine-2-carboxylate (PubChem CID 98144181) has the molecular formula C26H23Cl3N4O3S and a molecular weight of 577.92 g/mol. Its IUPAC name is methyl (3R)-4-(4-methoxyphenyl)-5-[N-(4-methylphenyl)-C-phenylcarbonimidoyl]imino-3-(trichloromethyl)-1,2,4-thiadiazolidine-2-carboxylate.
| Compound Name | methyl (3R)-4-(4-methoxyphenyl)-5-[N-(4-methylphenyl)-C-phenylcarbonimidoyl]imino-3-(trichloromethyl)-1,2,4-thiadiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 98144181 |
| Molecular Formula | C26H23Cl3N4O3S |
| Molecular Weight | 577.92 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | methyl (3R)-4-(4-methoxyphenyl)-5-[N-(4-methylphenyl)-C-phenylcarbonimidoyl]imino-3-(trichloromethyl)-1,2,4-thiadiazolidine-2-carboxylate |
| SMILES | COC(=O)N1S/C(=N\C(=N\c2ccc(C)cc2)c2ccccc2)N(c2ccc(OC)cc2)[C@H]1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H23Cl3N4O3S/c1-17-9-11-19(12-10-17)30-22(18-7-5-4-6-8-18)31-24-32(20-13-15-21(35-2)16-14-20)23(26(27,28)29)33(37-24)25(34)36-3/h4-16,23H,1-3H3/b30-22+,31-24-/t23-/m1/s1 |
| InChIKey | KJNUNBMJMKHNLS-IQIJZYKNSA-N |
| XLogP | 7.37 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.92 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|