C13H20Br3NO — CID 98146084
(1R,4S,6R)-6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-propan-2-ylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 98146084) has the molecular formula C13H20Br3NO and a molecular weight of 446.02 g/mol. Its IUPAC name is (1R,4S,6R)-6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-propan-2-ylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | (1R,4S,6R)-6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-propan-2-ylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 98146084 |
| Molecular Formula | C13H20Br3NO |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 442.91 |
| IUPAC Name | (1R,4S,6R)-6-bromo-4-(dibromomethyl)-5,5-dimethyl-N-propan-2-ylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC(C)NC(=O)[C@]12CC[C@@](C(Br)Br)([C@@H]1Br)C2(C)C |
| InChI | InChI=1S/C13H20Br3NO/c1-7(2)17-10(18)13-6-5-12(8(13)14,9(15)16)11(13,3)4/h7-9H,5-6H2,1-4H3,(H,17,18)/t8-,12-,13-/m0/s1 |
| InChIKey | JEAXZBDSWRBFJL-HJIKLVIJSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|