About morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone
morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone (PubChem CID 98146707) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone.
Molecular Properties
| Compound Name | morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone |
| PubChem CID | 98146707 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone |
| SMILES | O=C(N1CCOCC1)C12C[C@@H]3C[C@@H](C1)CC(c1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C21H26N2O4/c24-19(22-5-7-27-8-6-22)21-12-15-9-16(13-21)11-20(10-15,14-21)17-1-3-18(4-2-17)23(25)26/h1-4,15-16H,5-14H2/t15-,16-,20?,21?/m1/s1 |
| InChIKey | QJCKLNCMTGLKIJ-AJHHTPGJSA-N |
| XLogP | 3.29 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone?
The IUPAC name of morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone (CID 98146707) is morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone.
What is the SMILES notation for morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone?
The canonical SMILES for morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone is O=C(N1CCOCC1)C12C[C@@H]3C[C@@H](C1)CC(c1ccc([N+](=O)[O-])cc1)(C3)C2.
What is the InChIKey of morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone?
The InChIKey is QJCKLNCMTGLKIJ-AJHHTPGJSA-N. The full InChI is InChI=1S/C21H26N2O4/c24-19(22-5-7-27-8-6-22)21-12-15-9-16(13-21)11-20(10-15,14-21)17-1-3-18(4-2-17)23(25)26/h1-4,15-16H,5-14H2/t15-,16-,20?,21?/m1/s1.
What are the key properties of morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone?
morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone has a molecular weight of 370.45 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl-[(5R,7R)-3-(4-nitrophenyl)-1-adamantyl]methanone is sourced from PubChem (CID 98146707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).