C25H19F3N2O3 — CID 98148827
2-[(1R,2S,6R,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 98148827) has the molecular formula C25H19F3N2O3 and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[(1R,2S,6R,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[(1R,2S,6R,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 98148827 |
| Molecular Formula | C25H19F3N2O3 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[(1R,2S,6R,7S,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1ccccc1N1C(=O)[C@@H]2[C@H]3C=C[C@H]([C@H]4C[C@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C25H19F3N2O3/c26-25(27,28)17-6-2-3-7-18(17)29-22(31)14-5-1-4-8-19(14)30-23(32)20-12-9-10-13(16-11-15(12)16)21(20)24(30)33/h1-10,12-13,15-16,20-21H,11H2,(H,29,31)/t12-,13+,15-,16-,20+,21-/m1/s1 |
| InChIKey | FYXBUSSMZWGJKH-GGCCCZSWSA-N |
| XLogP | 4.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|