C25H20Cl2N2O4 — CID 98149958
(3S,3aR,6aS)-3-(3,5-dichloro-2-hydroxyphenyl)-5-(2,4-dimethylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98149958) has the molecular formula C25H20Cl2N2O4 and a molecular weight of 483.35 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-(3,5-dichloro-2-hydroxyphenyl)-5-(2,4-dimethylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aS)-3-(3,5-dichloro-2-hydroxyphenyl)-5-(2,4-dimethylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98149958 |
| Molecular Formula | C25H20Cl2N2O4 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | (3S,3aR,6aS)-3-(3,5-dichloro-2-hydroxyphenyl)-5-(2,4-dimethylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@H](ON(c4ccccc4)[C@@H]3c3cc(Cl)cc(Cl)c3O)C2=O)c(C)c1 |
| InChI | InChI=1S/C25H20Cl2N2O4/c1-13-8-9-19(14(2)10-13)28-24(31)20-21(17-11-15(26)12-18(27)22(17)30)29(33-23(20)25(28)32)16-6-4-3-5-7-16/h3-12,20-21,23,30H,1-2H3/t20-,21-,23+/m1/s1 |
| InChIKey | CBAPORZLOWXHFY-XPNTWCBSSA-N |
| XLogP | 5.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|