C18H24N4O — CID 98151603
(1R,3S,6R,7S)-6,7-dimethyl-4-[(Z)-1-pyridin-2-ylethylideneamino]-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide (PubChem CID 98151603) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (1R,3S,6R,7S)-6,7-dimethyl-4-[(Z)-1-pyridin-2-ylethylideneamino]-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide.
| Compound Name | (1R,3S,6R,7S)-6,7-dimethyl-4-[(Z)-1-pyridin-2-ylethylideneamino]-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 98151603 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (1R,3S,6R,7S)-6,7-dimethyl-4-[(Z)-1-pyridin-2-ylethylideneamino]-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide |
| SMILES | C/C(=N/N1C[C@]2(C)[C@@H]3CC[C@]2(C)[C@]1(C(N)=O)C3)c1ccccn1 |
| InChI | InChI=1S/C18H24N4O/c1-12(14-6-4-5-9-20-14)21-22-11-16(2)13-7-8-17(16,3)18(22,10-13)15(19)23/h4-6,9,13H,7-8,10-11H2,1-3H3,(H2,19,23)/b21-12-/t13-,16-,17+,18-/m1/s1 |
| InChIKey | YRMZBFWGLNVIJJ-YEOQXROKSA-N |
| XLogP | 2.17 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|